C19H17ClN2O3S — CID 168582594
1-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-hydroxy-4-phenylmethoxyphenyl]ethanone (PubChem CID 168582594) has the molecular formula C19H17ClN2O3S and a molecular weight of 388.88 g/mol. Its IUPAC name is 1-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-hydroxy-4-phenylmethoxyphenyl]ethanone.
| Compound Name | 1-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-hydroxy-4-phenylmethoxyphenyl]ethanone |
|---|---|
| PubChem CID | 168582594 |
| Molecular Formula | C19H17ClN2O3S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 1-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-hydroxy-4-phenylmethoxyphenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCc2ccccc2)c(NCc2cnc(Cl)s2)c1O |
| InChI | InChI=1S/C19H17ClN2O3S/c1-12(23)15-7-8-16(25-11-13-5-3-2-4-6-13)17(18(15)24)21-9-14-10-22-19(20)26-14/h2-8,10,21,24H,9,11H2,1H3 |
| InChIKey | SWTDCNCKYFKZDW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|