C18H16ClN3O2S — CID 168579723
4-(benzylamino)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoic acid (PubChem CID 168579723) has the molecular formula C18H16ClN3O2S and a molecular weight of 373.87 g/mol. Its IUPAC name is 4-(benzylamino)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoic acid.
| Compound Name | 4-(benzylamino)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 168579723 |
| Molecular Formula | C18H16ClN3O2S |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 4-(benzylamino)-3-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NCc2ccccc2)c(NCc2cnc(Cl)s2)c1 |
| InChI | InChI=1S/C18H16ClN3O2S/c19-18-22-11-14(25-18)10-21-16-8-13(17(23)24)6-7-15(16)20-9-12-4-2-1-3-5-12/h1-8,11,20-21H,9-10H2,(H,23,24) |
| InChIKey | UYJQGXNJBRSHFQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |