C17H12Cl2N2OS — CID 168580354
[5-chloro-2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]-phenylmethanone (PubChem CID 168580354) has the molecular formula C17H12Cl2N2OS and a molecular weight of 363.27 g/mol. Its IUPAC name is [5-chloro-2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]-phenylmethanone.
| Compound Name | [5-chloro-2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 168580354 |
| Molecular Formula | C17H12Cl2N2OS |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | [5-chloro-2-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cc(Cl)ccc1NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C17H12Cl2N2OS/c18-12-6-7-15(20-9-13-10-21-17(19)23-13)14(8-12)16(22)11-4-2-1-3-5-11/h1-8,10,20H,9H2 |
| InChIKey | OJONFNKFQHTENK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|