C18H15ClN2O2S — CID 168581543
methyl 3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzoate (PubChem CID 168581543) has the molecular formula C18H15ClN2O2S and a molecular weight of 358.85 g/mol. Its IUPAC name is methyl 3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzoate.
| Compound Name | methyl 3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzoate |
|---|---|
| PubChem CID | 168581543 |
| Molecular Formula | C18H15ClN2O2S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | methyl 3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzoate |
| SMILES | COC(=O)c1cccc(NCc2cnc(Cl)s2)c1-c1ccccc1 |
| InChI | InChI=1S/C18H15ClN2O2S/c1-23-17(22)14-8-5-9-15(16(14)12-6-3-2-4-7-12)20-10-13-11-21-18(19)24-13/h2-9,11,20H,10H2,1H3 |
| InChIKey | FVQRHUSYXYTHLH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |