C14H12ClN3OS — CID 168580254
2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-N-prop-2-ynylbenzamide (PubChem CID 168580254) has the molecular formula C14H12ClN3OS and a molecular weight of 305.79 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-N-prop-2-ynylbenzamide.
| Compound Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 168580254 |
| Molecular Formula | C14H12ClN3OS |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-N-prop-2-ynylbenzamide |
| SMILES | C#CCNC(=O)c1ccccc1NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C14H12ClN3OS/c1-2-7-16-13(19)11-5-3-4-6-12(11)17-8-10-9-18-14(15)20-10/h1,3-6,9,17H,7-8H2,(H,16,19) |
| InChIKey | YWELYAIXIIZJIO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|