C17H12ClN3O4S — CID 168581210
(4-nitrophenyl) 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate (PubChem CID 168581210) has the molecular formula C17H12ClN3O4S and a molecular weight of 389.82 g/mol. Its IUPAC name is (4-nitrophenyl) 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate.
| Compound Name | (4-nitrophenyl) 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 168581210 |
| Molecular Formula | C17H12ClN3O4S |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | (4-nitrophenyl) 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)c1ccccc1NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C17H12ClN3O4S/c18-17-20-10-13(26-17)9-19-15-4-2-1-3-14(15)16(22)25-12-7-5-11(6-8-12)21(23)24/h1-8,10,19H,9H2 |
| InChIKey | SRUCZSKQFADGBC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|