C12H9BrClN3O4S — CID 168579966
methyl 4-bromo-5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-nitrobenzoate (PubChem CID 168579966) has the molecular formula C12H9BrClN3O4S and a molecular weight of 406.65 g/mol. Its IUPAC name is methyl 4-bromo-5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-nitrobenzoate.
| Compound Name | methyl 4-bromo-5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-nitrobenzoate |
|---|---|
| PubChem CID | 168579966 |
| Molecular Formula | C12H9BrClN3O4S |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 404.92 |
| IUPAC Name | methyl 4-bromo-5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-nitrobenzoate |
| SMILES | COC(=O)c1cc(NCc2cnc(Cl)s2)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H9BrClN3O4S/c1-21-11(18)7-2-9(8(13)3-10(7)17(19)20)15-4-6-5-16-12(14)22-6/h2-3,5,15H,4H2,1H3 |
| InChIKey | CPRFVYCWMNOLRC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|