C11H9BrClN3O3S — CID 168579908
2-bromo-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methoxy-6-nitroaniline (PubChem CID 168579908) has the molecular formula C11H9BrClN3O3S and a molecular weight of 378.64 g/mol. Its IUPAC name is 2-bromo-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methoxy-6-nitroaniline.
| Compound Name | 2-bromo-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methoxy-6-nitroaniline |
|---|---|
| PubChem CID | 168579908 |
| Molecular Formula | C11H9BrClN3O3S |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 376.92 |
| IUPAC Name | 2-bromo-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-methoxy-6-nitroaniline |
| SMILES | COc1cc(Br)c(NCc2cnc(Cl)s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H9BrClN3O3S/c1-19-6-2-8(12)10(9(3-6)16(17)18)14-4-7-5-15-11(13)20-7/h2-3,5,14H,4H2,1H3 |
| InChIKey | JVGSEMLHZZNPBO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|