C14H15BrClN3O3S — CID 168580139
4-bromo-5-butoxy-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitroaniline (PubChem CID 168580139) has the molecular formula C14H15BrClN3O3S and a molecular weight of 420.72 g/mol. Its IUPAC name is 4-bromo-5-butoxy-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitroaniline.
| Compound Name | 4-bromo-5-butoxy-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitroaniline |
|---|---|
| PubChem CID | 168580139 |
| Molecular Formula | C14H15BrClN3O3S |
| Molecular Weight | 420.72 g/mol |
| Exact Mass | 418.97 |
| IUPAC Name | 4-bromo-5-butoxy-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitroaniline |
| SMILES | CCCCOc1cc(NCc2cnc(Cl)s2)c([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C14H15BrClN3O3S/c1-2-3-4-22-13-6-11(12(19(20)21)5-10(13)15)17-7-9-8-18-14(16)23-9/h5-6,8,17H,2-4,7H2,1H3 |
| InChIKey | MXMILGWHZIWQBU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.72 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|