C13H13ClN4O2S — CID 168583950
4-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-1-N-prop-2-enylbenzene-1,4-diamine (PubChem CID 168583950) has the molecular formula C13H13ClN4O2S and a molecular weight of 324.79 g/mol. Its IUPAC name is 4-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-1-N-prop-2-enylbenzene-1,4-diamine.
| Compound Name | 4-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-1-N-prop-2-enylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 168583950 |
| Molecular Formula | C13H13ClN4O2S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 4-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-1-N-prop-2-enylbenzene-1,4-diamine |
| SMILES | C=CCNc1ccc(NCc2cnc(Cl)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13ClN4O2S/c1-2-5-15-11-4-3-9(6-12(11)18(19)20)16-7-10-8-17-13(14)21-10/h2-4,6,8,15-16H,1,5,7H2 |
| InChIKey | OFJCTIUPJHUVFV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|