C11H9Cl2N3O2S — CID 104917275
2,6-dichloro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-4-nitroaniline (PubChem CID 104917275) has the molecular formula C11H9Cl2N3O2S and a molecular weight of 318.19 g/mol. Its IUPAC name is 2,6-dichloro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-4-nitroaniline.
| Compound Name | 2,6-dichloro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-4-nitroaniline |
|---|---|
| PubChem CID | 104917275 |
| Molecular Formula | C11H9Cl2N3O2S |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | 2,6-dichloro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-4-nitroaniline |
| SMILES | Cc1ncc(CNc2c(Cl)cc([N+](=O)[O-])cc2Cl)s1 |
| InChI | InChI=1S/C11H9Cl2N3O2S/c1-6-14-4-8(19-6)5-15-11-9(12)2-7(16(17)18)3-10(11)13/h2-4,15H,5H2,1H3 |
| InChIKey | RWXBOZIQETWIGV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|