C17H14ClN3O2S2 — CID 168583294
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(4-methylphenyl)sulfanyl-5-nitroaniline (PubChem CID 168583294) has the molecular formula C17H14ClN3O2S2 and a molecular weight of 391.91 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(4-methylphenyl)sulfanyl-5-nitroaniline.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(4-methylphenyl)sulfanyl-5-nitroaniline |
|---|---|
| PubChem CID | 168583294 |
| Molecular Formula | C17H14ClN3O2S2 |
| Molecular Weight | 391.91 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(4-methylphenyl)sulfanyl-5-nitroaniline |
| SMILES | Cc1ccc(Sc2cc(NCc3cnc(Cl)s3)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H14ClN3O2S2/c1-11-2-4-14(5-3-11)24-15-7-12(6-13(8-15)21(22)23)19-9-16-10-20-17(18)25-16/h2-8,10,19H,9H2,1H3 |
| InChIKey | UCUQYLRFUUGUHR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.91 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|