C16H10ClF2N3O3S — CID 168581898
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(2,4-difluorophenoxy)-5-nitroaniline (PubChem CID 168581898) has the molecular formula C16H10ClF2N3O3S and a molecular weight of 397.79 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(2,4-difluorophenoxy)-5-nitroaniline.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(2,4-difluorophenoxy)-5-nitroaniline |
|---|---|
| PubChem CID | 168581898 |
| Molecular Formula | C16H10ClF2N3O3S |
| Molecular Weight | 397.79 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(2,4-difluorophenoxy)-5-nitroaniline |
| SMILES | O=[N+]([O-])c1cc(NCc2cnc(Cl)s2)cc(Oc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C16H10ClF2N3O3S/c17-16-21-8-13(26-16)7-20-10-4-11(22(23)24)6-12(5-10)25-15-2-1-9(18)3-14(15)19/h1-6,8,20H,7H2 |
| InChIKey | JNJCBNOFHLGXGB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.79 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|