C10H6ClF2NOS — CID 79764988
2-chloro-5-[(2,4-difluorophenoxy)methyl]-1,3-thiazole (PubChem CID 79764988) has the molecular formula C10H6ClF2NOS and a molecular weight of 261.68 g/mol. Its IUPAC name is 2-chloro-5-[(2,4-difluorophenoxy)methyl]-1,3-thiazole.
| Compound Name | 2-chloro-5-[(2,4-difluorophenoxy)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 79764988 |
| Molecular Formula | C10H6ClF2NOS |
| Molecular Weight | 261.68 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 2-chloro-5-[(2,4-difluorophenoxy)methyl]-1,3-thiazole |
| SMILES | Fc1ccc(OCc2cnc(Cl)s2)c(F)c1 |
| InChI | InChI=1S/C10H6ClF2NOS/c11-10-14-4-7(16-10)5-15-9-2-1-6(12)3-8(9)13/h1-4H,5H2 |
| InChIKey | FLOFVWIGTNYPJV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.68 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |