C10H6BrClFNOS — CID 81496091
5-[(2-bromo-5-fluorophenoxy)methyl]-2-chloro-1,3-thiazole (PubChem CID 81496091) has the molecular formula C10H6BrClFNOS and a molecular weight of 322.59 g/mol. Its IUPAC name is 5-[(2-bromo-5-fluorophenoxy)methyl]-2-chloro-1,3-thiazole.
| Compound Name | 5-[(2-bromo-5-fluorophenoxy)methyl]-2-chloro-1,3-thiazole |
|---|---|
| PubChem CID | 81496091 |
| Molecular Formula | C10H6BrClFNOS |
| Molecular Weight | 322.59 g/mol |
| Exact Mass | 320.90 |
| IUPAC Name | 5-[(2-bromo-5-fluorophenoxy)methyl]-2-chloro-1,3-thiazole |
| SMILES | Fc1ccc(Br)c(OCc2cnc(Cl)s2)c1 |
| InChI | InChI=1S/C10H6BrClFNOS/c11-8-2-1-6(13)3-9(8)15-5-7-4-14-10(12)16-7/h1-4H,5H2 |
| InChIKey | MCKLHOGVWCXCGF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |