C12H7BrCl2FNO — CID 116519513
5-[(2-bromo-5-fluorophenoxy)methyl]-2,4-dichloropyridine (PubChem CID 116519513) has the molecular formula C12H7BrCl2FNO and a molecular weight of 351.00 g/mol. Its IUPAC name is 5-[(2-bromo-5-fluorophenoxy)methyl]-2,4-dichloropyridine.
| Compound Name | 5-[(2-bromo-5-fluorophenoxy)methyl]-2,4-dichloropyridine |
|---|---|
| PubChem CID | 116519513 |
| Molecular Formula | C12H7BrCl2FNO |
| Molecular Weight | 351.00 g/mol |
| Exact Mass | 348.91 |
| IUPAC Name | 5-[(2-bromo-5-fluorophenoxy)methyl]-2,4-dichloropyridine |
| SMILES | Fc1ccc(Br)c(OCc2cnc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C12H7BrCl2FNO/c13-9-2-1-8(16)3-11(9)18-6-7-5-17-12(15)4-10(7)14/h1-5H,6H2 |
| InChIKey | LOSJVHCMYZARCU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.00 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|