C12H8Cl2FNO — CID 116519330
2,4-dichloro-5-[(2-fluorophenoxy)methyl]pyridine (PubChem CID 116519330) has the molecular formula C12H8Cl2FNO and a molecular weight of 272.11 g/mol. Its IUPAC name is 2,4-dichloro-5-[(2-fluorophenoxy)methyl]pyridine.
| Compound Name | 2,4-dichloro-5-[(2-fluorophenoxy)methyl]pyridine |
|---|---|
| PubChem CID | 116519330 |
| Molecular Formula | C12H8Cl2FNO |
| Molecular Weight | 272.11 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 2,4-dichloro-5-[(2-fluorophenoxy)methyl]pyridine |
| SMILES | Fc1ccccc1OCc1cnc(Cl)cc1Cl |
| InChI | InChI=1S/C12H8Cl2FNO/c13-9-5-12(14)16-6-8(9)7-17-11-4-2-1-3-10(11)15/h1-6H,7H2 |
| InChIKey | QSEBSJRGGOPNOM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.11 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|