C12H9Cl2FN2O — CID 82169669
4,6-dichloro-2-[2-(2-fluorophenoxy)ethyl]pyrimidine (PubChem CID 82169669) has the molecular formula C12H9Cl2FN2O and a molecular weight of 287.12 g/mol. Its IUPAC name is 4,6-dichloro-2-[2-(2-fluorophenoxy)ethyl]pyrimidine.
| Compound Name | 4,6-dichloro-2-[2-(2-fluorophenoxy)ethyl]pyrimidine |
|---|---|
| PubChem CID | 82169669 |
| Molecular Formula | C12H9Cl2FN2O |
| Molecular Weight | 287.12 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 4,6-dichloro-2-[2-(2-fluorophenoxy)ethyl]pyrimidine |
| SMILES | Fc1ccccc1OCCc1nc(Cl)cc(Cl)n1 |
| InChI | InChI=1S/C12H9Cl2FN2O/c13-10-7-11(14)17-12(16-10)5-6-18-9-4-2-1-3-8(9)15/h1-4,7H,5-6H2 |
| InChIKey | MNUFBGFYELEULL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.12 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |