C13H11FN4O — CID 82168405
4-amino-2-[2-(2-fluorophenoxy)ethyl]pyrimidine-5-carbonitrile (PubChem CID 82168405) has the molecular formula C13H11FN4O and a molecular weight of 258.26 g/mol. Its IUPAC name is 4-amino-2-[2-(2-fluorophenoxy)ethyl]pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-[2-(2-fluorophenoxy)ethyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 82168405 |
| Molecular Formula | C13H11FN4O |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 4-amino-2-[2-(2-fluorophenoxy)ethyl]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(CCOc2ccccc2F)nc1N |
| InChI | InChI=1S/C13H11FN4O/c14-10-3-1-2-4-11(10)19-6-5-12-17-8-9(7-15)13(16)18-12/h1-4,8H,5-6H2,(H2,16,17,18) |
| InChIKey | YCEKDWQKFHUZDC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |