C11H11FN2O2 — CID 82080194
3-[2-(2-fluorophenoxy)ethyl]-1,2-oxazol-5-amine (PubChem CID 82080194) has the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. Its IUPAC name is 3-[2-(2-fluorophenoxy)ethyl]-1,2-oxazol-5-amine.
| Compound Name | 3-[2-(2-fluorophenoxy)ethyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 82080194 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 3-[2-(2-fluorophenoxy)ethyl]-1,2-oxazol-5-amine |
| SMILES | Nc1cc(CCOc2ccccc2F)no1 |
| InChI | InChI=1S/C11H11FN2O2/c12-9-3-1-2-4-10(9)15-6-5-8-7-11(13)16-14-8/h1-4,7H,5-6,13H2 |
| InChIKey | FXDCTYKQNLXFEP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |