C6H11N3O — CID 83845440
3-(3-aminopropyl)-1,2-oxazol-5-amine (PubChem CID 83845440) has the molecular formula C6H11N3O and a molecular weight of 141.17 g/mol. Its IUPAC name is 3-(3-aminopropyl)-1,2-oxazol-5-amine.
| Compound Name | 3-(3-aminopropyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 83845440 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 3-(3-aminopropyl)-1,2-oxazol-5-amine |
| SMILES | NCCCc1cc(N)on1 |
| InChI | InChI=1S/C6H11N3O/c7-3-1-2-5-4-6(8)10-9-5/h4H,1-3,7-8H2 |
| InChIKey | MSHHHZNVILAGPT-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |