C11H11ClN2O — CID 82080374
3-[2-(3-chlorophenyl)ethyl]-1,2-oxazol-5-amine (PubChem CID 82080374) has the molecular formula C11H11ClN2O and a molecular weight of 222.68 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)ethyl]-1,2-oxazol-5-amine.
| Compound Name | 3-[2-(3-chlorophenyl)ethyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 82080374 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 3-[2-(3-chlorophenyl)ethyl]-1,2-oxazol-5-amine |
| SMILES | Nc1cc(CCc2cccc(Cl)c2)no1 |
| InChI | InChI=1S/C11H11ClN2O/c12-9-3-1-2-8(6-9)4-5-10-7-11(13)15-14-10/h1-3,6-7H,4-5,13H2 |
| InChIKey | VOYBSAAZKVAVAA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |