About 1-[3-(2-phenylethyl)-1,2-oxazol-5-yl]ethanamine
1-[3-(2-phenylethyl)-1,2-oxazol-5-yl]ethanamine (PubChem CID 114420254) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-[3-(2-phenylethyl)-1,2-oxazol-5-yl]ethanamine.
Molecular Properties
| Compound Name | 1-[3-(2-phenylethyl)-1,2-oxazol-5-yl]ethanamine |
| PubChem CID | 114420254 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-[3-(2-phenylethyl)-1,2-oxazol-5-yl]ethanamine |
| SMILES | CC(N)c1cc(CCc2ccccc2)no1 |
| InChI | InChI=1S/C13H16N2O/c1-10(14)13-9-12(15-16-13)8-7-11-5-3-2-4-6-11/h2-6,9-10H,7-8,14H2,1H3 |
| InChIKey | DHSXGXKWJRWZLN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-(2-phenylethyl)-1,2-oxazol-5-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2-phenylethyl)-1,2-oxazol-5-yl]ethanamine?
The IUPAC name of 1-[3-(2-phenylethyl)-1,2-oxazol-5-yl]ethanamine (CID 114420254) is 1-[3-(2-phenylethyl)-1,2-oxazol-5-yl]ethanamine.
What is the SMILES notation for 1-[3-(2-phenylethyl)-1,2-oxazol-5-yl]ethanamine?
The canonical SMILES for 1-[3-(2-phenylethyl)-1,2-oxazol-5-yl]ethanamine is CC(N)c1cc(CCc2ccccc2)no1.
What is the InChIKey of 1-[3-(2-phenylethyl)-1,2-oxazol-5-yl]ethanamine?
The InChIKey is DHSXGXKWJRWZLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O/c1-10(14)13-9-12(15-16-13)8-7-11-5-3-2-4-6-11/h2-6,9-10H,7-8,14H2,1H3.
What are the key properties of 1-[3-(2-phenylethyl)-1,2-oxazol-5-yl]ethanamine?
1-[3-(2-phenylethyl)-1,2-oxazol-5-yl]ethanamine has a molecular weight of 216.28 g/mol, XLogP of 2.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2-phenylethyl)-1,2-oxazol-5-yl]ethanamine is sourced from PubChem (CID 114420254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).