C10H8F2N2O2 — CID 82080942
3-[(2,4-difluorophenoxy)methyl]-1,2-oxazol-5-amine (PubChem CID 82080942) has the molecular formula C10H8F2N2O2 and a molecular weight of 226.18 g/mol. Its IUPAC name is 3-[(2,4-difluorophenoxy)methyl]-1,2-oxazol-5-amine.
| Compound Name | 3-[(2,4-difluorophenoxy)methyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 82080942 |
| Molecular Formula | C10H8F2N2O2 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 3-[(2,4-difluorophenoxy)methyl]-1,2-oxazol-5-amine |
| SMILES | Nc1cc(COc2ccc(F)cc2F)no1 |
| InChI | InChI=1S/C10H8F2N2O2/c11-6-1-2-9(8(12)3-6)15-5-7-4-10(13)16-14-7/h1-4H,5,13H2 |
| InChIKey | KPDXMQAKIPTRFL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |