C13H14ClNOS — CID 79765645
2-chloro-5-[(2-propan-2-ylphenoxy)methyl]-1,3-thiazole (PubChem CID 79765645) has the molecular formula C13H14ClNOS and a molecular weight of 267.78 g/mol. Its IUPAC name is 2-chloro-5-[(2-propan-2-ylphenoxy)methyl]-1,3-thiazole.
| Compound Name | 2-chloro-5-[(2-propan-2-ylphenoxy)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 79765645 |
| Molecular Formula | C13H14ClNOS |
| Molecular Weight | 267.78 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 2-chloro-5-[(2-propan-2-ylphenoxy)methyl]-1,3-thiazole |
| SMILES | CC(C)c1ccccc1OCc1cnc(Cl)s1 |
| InChI | InChI=1S/C13H14ClNOS/c1-9(2)11-5-3-4-6-12(11)16-8-10-7-15-13(14)17-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | ITXMDXNGLWUKKV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.78 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |