C10H7ClF2N2O2 — CID 39360983
2-(chloromethyl)-5-[(2,4-difluorophenoxy)methyl]-1,3,4-oxadiazole (PubChem CID 39360983) has the molecular formula C10H7ClF2N2O2 and a molecular weight of 260.63 g/mol. Its IUPAC name is 2-(chloromethyl)-5-[(2,4-difluorophenoxy)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-(chloromethyl)-5-[(2,4-difluorophenoxy)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 39360983 |
| Molecular Formula | C10H7ClF2N2O2 |
| Molecular Weight | 260.63 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 2-(chloromethyl)-5-[(2,4-difluorophenoxy)methyl]-1,3,4-oxadiazole |
| SMILES | Fc1ccc(OCc2nnc(CCl)o2)c(F)c1 |
| InChI | InChI=1S/C10H7ClF2N2O2/c11-4-9-14-15-10(17-9)5-16-8-2-1-6(12)3-7(8)13/h1-3H,4-5H2 |
| InChIKey | MAPADWQEWAKQJR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.63 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|