C10H8ClN3O6S2 — CID 168580618
3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-hydroxy-5-nitrobenzenesulfonic acid (PubChem CID 168580618) has the molecular formula C10H8ClN3O6S2 and a molecular weight of 365.78 g/mol. Its IUPAC name is 3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-hydroxy-5-nitrobenzenesulfonic acid.
| Compound Name | 3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-hydroxy-5-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 168580618 |
| Molecular Formula | C10H8ClN3O6S2 |
| Molecular Weight | 365.78 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | 3-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-hydroxy-5-nitrobenzenesulfonic acid |
| SMILES | O=[N+]([O-])c1cc(NCc2cnc(Cl)s2)c(O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C10H8ClN3O6S2/c11-10-13-4-6(21-10)3-12-7-1-5(14(16)17)2-8(9(7)15)22(18,19)20/h1-2,4,12,15H,3H2,(H,18,19,20) |
| InChIKey | YXAOOLSWMVXNLB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 142.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.78 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|