C11H9BrClIN2S — CID 168582754
4-bromo-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-iodo-3-methylaniline (PubChem CID 168582754) has the molecular formula C11H9BrClIN2S and a molecular weight of 443.54 g/mol. Its IUPAC name is 4-bromo-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-iodo-3-methylaniline.
| Compound Name | 4-bromo-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-iodo-3-methylaniline |
|---|---|
| PubChem CID | 168582754 |
| Molecular Formula | C11H9BrClIN2S |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 441.84 |
| IUPAC Name | 4-bromo-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-iodo-3-methylaniline |
| SMILES | Cc1c(Br)ccc(NCc2cnc(Cl)s2)c1I |
| InChI | InChI=1S/C11H9BrClIN2S/c1-6-8(12)2-3-9(10(6)14)15-4-7-5-16-11(13)17-7/h2-3,5,15H,4H2,1H3 |
| InChIKey | YVBMLADNMOXQBQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|