C28H30N6O4S — CID 86656298
5-[[4-[2-(ethylamino)-4-(3-methoxy-5-methylphenyl)-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]-2-morpholin-4-ylbenzoic acid (PubChem CID 86656298) has the molecular formula C28H30N6O4S and a molecular weight of 546.65 g/mol. Its IUPAC name is 5-[[4-[2-(ethylamino)-4-(3-methoxy-5-methylphenyl)-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]-2-morpholin-4-ylbenzoic acid.
| Compound Name | 5-[[4-[2-(ethylamino)-4-(3-methoxy-5-methylphenyl)-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]-2-morpholin-4-ylbenzoic acid |
|---|---|
| PubChem CID | 86656298 |
| Molecular Formula | C28H30N6O4S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 5-[[4-[2-(ethylamino)-4-(3-methoxy-5-methylphenyl)-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]-2-morpholin-4-ylbenzoic acid |
| SMILES | CCNc1nc(-c2cc(C)cc(OC)c2)c(-c2ccnc(Nc3ccc(N4CCOCC4)c(C(=O)O)c3)n2)s1 |
| InChI | InChI=1S/C28H30N6O4S/c1-4-29-28-33-24(18-13-17(2)14-20(15-18)37-3)25(39-28)22-7-8-30-27(32-22)31-19-5-6-23(21(16-19)26(35)36)34-9-11-38-12-10-34/h5-8,13-16H,4,9-12H2,1-3H3,(H,29,33)(H,35,36)(H,30,31,32) |
| InChIKey | FBWYJYGJPKJXIJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|