C20H22N6O — CID 59198045
4-methyl-3-N-[4-(5-morpholin-4-yl-3-pyridinyl)pyrimidin-2-yl]benzene-1,3-diamine (PubChem CID 59198045) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is 4-methyl-3-N-[4-(5-morpholin-4-yl-3-pyridinyl)pyrimidin-2-yl]benzene-1,3-diamine.
| Compound Name | 4-methyl-3-N-[4-(5-morpholin-4-yl-3-pyridinyl)pyrimidin-2-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 59198045 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 4-methyl-3-N-[4-(5-morpholin-4-yl-3-pyridinyl)pyrimidin-2-yl]benzene-1,3-diamine |
| SMILES | Cc1ccc(N)cc1Nc1nccc(-c2cncc(N3CCOCC3)c2)n1 |
| InChI | InChI=1S/C20H22N6O/c1-14-2-3-16(21)11-19(14)25-20-23-5-4-18(24-20)15-10-17(13-22-12-15)26-6-8-27-9-7-26/h2-5,10-13H,6-9,21H2,1H3,(H,23,24,25) |
| InChIKey | JNBPXVQRGPLAOW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|