C17H16FN5S — CID 10427423
5-[2-(4-fluoroanilino)pyrimidin-4-yl]-4-methyl-N-prop-2-enyl-1,3-thiazol-2-amine (PubChem CID 10427423) has the molecular formula C17H16FN5S and a molecular weight of 341.42 g/mol. Its IUPAC name is 5-[2-(4-fluoroanilino)pyrimidin-4-yl]-4-methyl-N-prop-2-enyl-1,3-thiazol-2-amine.
| Compound Name | 5-[2-(4-fluoroanilino)pyrimidin-4-yl]-4-methyl-N-prop-2-enyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 10427423 |
| Molecular Formula | C17H16FN5S |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 5-[2-(4-fluoroanilino)pyrimidin-4-yl]-4-methyl-N-prop-2-enyl-1,3-thiazol-2-amine |
| SMILES | C=CCNc1nc(C)c(-c2ccnc(Nc3ccc(F)cc3)n2)s1 |
| InChI | InChI=1S/C17H16FN5S/c1-3-9-20-17-21-11(2)15(24-17)14-8-10-19-16(23-14)22-13-6-4-12(18)5-7-13/h3-8,10H,1,9H2,2H3,(H,20,21)(H,19,22,23) |
| InChIKey | REFPKDGBZGRYKO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|