C14H12BN5S — CID 89370521
CID 89370521 (PubChem CID 89370521) has the molecular formula C14H12BN5S and a molecular weight of 293.16 g/mol.
| Compound Name | CID 89370521 |
|---|---|
| PubChem CID | 89370521 |
| Molecular Formula | C14H12BN5S |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(Nc2nccc(-c3sc(N)nc3C)n2)c1 |
| InChI | InChI=1S/C14H12BN5S/c1-8-12(21-13(16)18-8)11-5-6-17-14(20-11)19-10-4-2-3-9(15)7-10/h2-7H,1H3,(H2,16,18)(H,17,19,20) |
| InChIKey | RSFYYFPICCWIEK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|