C28H36N8O6 — CID 142742522
[1-[3-[[2-[2-(methoxymethoxy)-4-(4-methylpiperazin-1-yl)anilino]-5-nitropyrimidin-4-yl]amino]phenyl]-2-methylpropan-2-yl] carbamate (PubChem CID 142742522) has the molecular formula C28H36N8O6 and a molecular weight of 580.65 g/mol. Its IUPAC name is [1-[3-[[2-[2-(methoxymethoxy)-4-(4-methylpiperazin-1-yl)anilino]-5-nitropyrimidin-4-yl]amino]phenyl]-2-methylpropan-2-yl] carbamate.
| Compound Name | [1-[3-[[2-[2-(methoxymethoxy)-4-(4-methylpiperazin-1-yl)anilino]-5-nitropyrimidin-4-yl]amino]phenyl]-2-methylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 142742522 |
| Molecular Formula | C28H36N8O6 |
| Molecular Weight | 580.65 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | [1-[3-[[2-[2-(methoxymethoxy)-4-(4-methylpiperazin-1-yl)anilino]-5-nitropyrimidin-4-yl]amino]phenyl]-2-methylpropan-2-yl] carbamate |
| SMILES | COCOc1cc(N2CCN(C)CC2)ccc1Nc1ncc([N+](=O)[O-])c(Nc2cccc(CC(C)(C)OC(N)=O)c2)n1 |
| InChI | InChI=1S/C28H36N8O6/c1-28(2,42-26(29)37)16-19-6-5-7-20(14-19)31-25-23(36(38)39)17-30-27(33-25)32-22-9-8-21(15-24(22)41-18-40-4)35-12-10-34(3)11-13-35/h5-9,14-15,17H,10-13,16,18H2,1-4H3,(H2,29,37)(H2,30,31,32,33) |
| InChIKey | RYAQCQMSQACCPA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 170.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.65 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|