C16H20N6O2 — CID 67995022
3-N-[6-(4-methylpiperazin-1-yl)-3-nitro-2-pyridinyl]benzene-1,3-diamine (PubChem CID 67995022) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is 3-N-[6-(4-methylpiperazin-1-yl)-3-nitro-2-pyridinyl]benzene-1,3-diamine.
| Compound Name | 3-N-[6-(4-methylpiperazin-1-yl)-3-nitro-2-pyridinyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 67995022 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 3-N-[6-(4-methylpiperazin-1-yl)-3-nitro-2-pyridinyl]benzene-1,3-diamine |
| SMILES | CN1CCN(c2ccc([N+](=O)[O-])c(Nc3cccc(N)c3)n2)CC1 |
| InChI | InChI=1S/C16H20N6O2/c1-20-7-9-21(10-8-20)15-6-5-14(22(23)24)16(19-15)18-13-4-2-3-12(17)11-13/h2-6,11H,7-10,17H2,1H3,(H,18,19) |
| InChIKey | FCLYPPXXAGEZIS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 100.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|