C19H23N5O2 — CID 133273122
N-[3-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]-3-nitropyridin-2-amine (PubChem CID 133273122) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is N-[3-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]-3-nitropyridin-2-amine.
| Compound Name | N-[3-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 133273122 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | N-[3-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cccnc1Nc1cccc(N2CCN(CC3CC3)CC2)c1 |
| InChI | InChI=1S/C19H23N5O2/c25-24(26)18-5-2-8-20-19(18)21-16-3-1-4-17(13-16)23-11-9-22(10-12-23)14-15-6-7-15/h1-5,8,13,15H,6-7,9-12,14H2,(H,20,21) |
| InChIKey | WJEXUOFLAPHGBZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|