C29H34N8O5 — CID 145331321
tert-butyl N-[3-[2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-6,7-dioxo-5H-pteridin-8-yl]phenyl]carbamate (PubChem CID 145331321) has the molecular formula C29H34N8O5 and a molecular weight of 574.64 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-6,7-dioxo-5H-pteridin-8-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-6,7-dioxo-5H-pteridin-8-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 145331321 |
| Molecular Formula | C29H34N8O5 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | tert-butyl N-[3-[2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-6,7-dioxo-5H-pteridin-8-yl]phenyl]carbamate |
| SMILES | COc1cc(N2CCN(C)CC2)ccc1Nc1ncc2[nH]c(=O)c(=O)n(-c3cccc(NC(=O)OC(C)(C)C)c3)c2n1 |
| InChI | InChI=1S/C29H34N8O5/c1-29(2,3)42-28(40)31-18-7-6-8-20(15-18)37-24-22(32-25(38)26(37)39)17-30-27(34-24)33-21-10-9-19(16-23(21)41-5)36-13-11-35(4)12-14-36/h6-10,15-17H,11-14H2,1-5H3,(H,31,40)(H,32,38)(H,30,33,34) |
| InChIKey | WAYQLBDUOHJDSQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 146.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|