C35H39N9O2 — CID 145360621
8-(3-aminophenyl)-2-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6-phenylpteridin-7-one (PubChem CID 145360621) has the molecular formula C35H39N9O2 and a molecular weight of 617.76 g/mol. Its IUPAC name is 8-(3-aminophenyl)-2-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6-phenylpteridin-7-one.
| Compound Name | 8-(3-aminophenyl)-2-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6-phenylpteridin-7-one |
|---|---|
| PubChem CID | 145360621 |
| Molecular Formula | C35H39N9O2 |
| Molecular Weight | 617.76 g/mol |
| Exact Mass | 617.32 |
| IUPAC Name | 8-(3-aminophenyl)-2-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6-phenylpteridin-7-one |
| SMILES | COc1cc(N2CCC(N3CCN(C)CC3)CC2)ccc1Nc1ncc2nc(-c3ccccc3)c(=O)n(-c3cccc(N)c3)c2n1 |
| InChI | InChI=1S/C35H39N9O2/c1-41-17-19-43(20-18-41)26-13-15-42(16-14-26)27-11-12-29(31(22-27)46-2)39-35-37-23-30-33(40-35)44(28-10-6-9-25(36)21-28)34(45)32(38-30)24-7-4-3-5-8-24/h3-12,21-23,26H,13-20,36H2,1-2H3,(H,37,39,40) |
| InChIKey | HETLRNUWQZKJLU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.76 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|