C32H33N9O2 — CID 175128547
N-[2-[8-anilino-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]phenyl]prop-2-enamide (PubChem CID 175128547) has the molecular formula C32H33N9O2 and a molecular weight of 575.68 g/mol. Its IUPAC name is N-[2-[8-anilino-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]phenyl]prop-2-enamide.
| Compound Name | N-[2-[8-anilino-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175128547 |
| Molecular Formula | C32H33N9O2 |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | N-[2-[8-anilino-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1-n1c(Nc2ccccc2)nc2cnc(Nc3ccc(N4CCN(C)CC4)cc3OC)nc21 |
| InChI | InChI=1S/C32H33N9O2/c1-4-29(42)35-24-12-8-9-13-27(24)41-30-26(37-32(41)34-22-10-6-5-7-11-22)21-33-31(38-30)36-25-15-14-23(20-28(25)43-3)40-18-16-39(2)17-19-40/h4-15,20-21H,1,16-19H2,2-3H3,(H,34,37)(H,35,42)(H,33,36,38) |
| InChIKey | KZQYWIRCEOTNTD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|