C21H33N3O5 — CID 171785558
tert-butyl 4-[4-[(3-ethoxy-3-oxopropyl)amino]-3-methoxyphenyl]piperazine-1-carboxylate (PubChem CID 171785558) has the molecular formula C21H33N3O5 and a molecular weight of 407.51 g/mol. Its IUPAC name is tert-butyl 4-[4-[(3-ethoxy-3-oxopropyl)amino]-3-methoxyphenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(3-ethoxy-3-oxopropyl)amino]-3-methoxyphenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171785558 |
| Molecular Formula | C21H33N3O5 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | tert-butyl 4-[4-[(3-ethoxy-3-oxopropyl)amino]-3-methoxyphenyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)CCNc1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1OC |
| InChI | InChI=1S/C21H33N3O5/c1-6-28-19(25)9-10-22-17-8-7-16(15-18(17)27-5)23-11-13-24(14-12-23)20(26)29-21(2,3)4/h7-8,15,22H,6,9-14H2,1-5H3 |
| InChIKey | ALDKZTVAWHWTMZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |