C22H26N6O3 — CID 171795691
tert-butyl 4-[2-[(4-oxo-3H-quinazolin-2-yl)amino]-4-pyridinyl]piperazine-1-carboxylate (PubChem CID 171795691) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is tert-butyl 4-[2-[(4-oxo-3H-quinazolin-2-yl)amino]-4-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(4-oxo-3H-quinazolin-2-yl)amino]-4-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171795691 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | tert-butyl 4-[2-[(4-oxo-3H-quinazolin-2-yl)amino]-4-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccnc(Nc3nc4ccccc4c(=O)[nH]3)c2)CC1 |
| InChI | InChI=1S/C22H26N6O3/c1-22(2,3)31-21(30)28-12-10-27(11-13-28)15-8-9-23-18(14-15)25-20-24-17-7-5-4-6-16(17)19(29)26-20/h4-9,14H,10-13H2,1-3H3,(H2,23,24,25,26,29) |
| InChIKey | ZUQDCSCAAIPEOO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |