C17H24IN5O3 — CID 137045865
tert-butyl 4-(8-methyl-4-oxo-3H-pyrido[2,3-d]pyrimidin-8-ium-2-yl)piperazine-1-carboxylate iodide (PubChem CID 137045865) has the molecular formula C17H24IN5O3 and a molecular weight of 473.32 g/mol. Its IUPAC name is tert-butyl 4-(8-methyl-4-oxo-3H-pyrido[2,3-d]pyrimidin-8-ium-2-yl)piperazine-1-carboxylate iodide.
| Compound Name | tert-butyl 4-(8-methyl-4-oxo-3H-pyrido[2,3-d]pyrimidin-8-ium-2-yl)piperazine-1-carboxylate iodide |
|---|---|
| PubChem CID | 137045865 |
| Molecular Formula | C17H24IN5O3 |
| Molecular Weight | 473.32 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | tert-butyl 4-(8-methyl-4-oxo-3H-pyrido[2,3-d]pyrimidin-8-ium-2-yl)piperazine-1-carboxylate iodide |
| SMILES | C[n+]1cccc2c(=O)[nH]c(N3CCN(C(=O)OC(C)(C)C)CC3)nc21.[I-] |
| InChI | InChI=1S/C17H23N5O3.HI/c1-17(2,3)25-16(24)22-10-8-21(9-11-22)15-18-13-12(14(23)19-15)6-5-7-20(13)4;/h5-7H,8-11H2,1-4H3;1H |
| InChIKey | UZYRVAFLFULVLU-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 82.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.32 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|