C18H24N4O3 — CID 137267489
tert-butyl (2R)-2-methyl-4-(4-oxo-3H-quinazolin-2-yl)piperazine-1-carboxylate (PubChem CID 137267489) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is tert-butyl (2R)-2-methyl-4-(4-oxo-3H-quinazolin-2-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-methyl-4-(4-oxo-3H-quinazolin-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 137267489 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | tert-butyl (2R)-2-methyl-4-(4-oxo-3H-quinazolin-2-yl)piperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2nc3ccccc3c(=O)[nH]2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24N4O3/c1-12-11-21(9-10-22(12)17(24)25-18(2,3)4)16-19-14-8-6-5-7-13(14)15(23)20-16/h5-8,12H,9-11H2,1-4H3,(H,19,20,23)/t12-/m1/s1 |
| InChIKey | HSQOBYLFSNOSDT-GFCCVEGCSA-N |
| XLogP | 2.37 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |