C19H26N4O3 — CID 137268454
tert-butyl N-[[1-(4-oxo-3H-quinazolin-2-yl)piperidin-3-yl]methyl]carbamate (PubChem CID 137268454) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is tert-butyl N-[[1-(4-oxo-3H-quinazolin-2-yl)piperidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(4-oxo-3H-quinazolin-2-yl)piperidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 137268454 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | tert-butyl N-[[1-(4-oxo-3H-quinazolin-2-yl)piperidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCN(c2nc3ccccc3c(=O)[nH]2)C1 |
| InChI | InChI=1S/C19H26N4O3/c1-19(2,3)26-18(25)20-11-13-7-6-10-23(12-13)17-21-15-9-5-4-8-14(15)16(24)22-17/h4-5,8-9,13H,6-7,10-12H2,1-3H3,(H,20,25)(H,21,22,24) |
| InChIKey | OKPOXNWWTQYDAQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |