C22H30ClN3O2 — CID 60587914
tert-butyl N-[[1-[(3-chloro-4-methylquinolin-2-yl)methyl]piperidin-3-yl]methyl]carbamate (PubChem CID 60587914) has the molecular formula C22H30ClN3O2 and a molecular weight of 403.95 g/mol. Its IUPAC name is tert-butyl N-[[1-[(3-chloro-4-methylquinolin-2-yl)methyl]piperidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[(3-chloro-4-methylquinolin-2-yl)methyl]piperidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 60587914 |
| Molecular Formula | C22H30ClN3O2 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | tert-butyl N-[[1-[(3-chloro-4-methylquinolin-2-yl)methyl]piperidin-3-yl]methyl]carbamate |
| SMILES | Cc1c(Cl)c(CN2CCCC(CNC(=O)OC(C)(C)C)C2)nc2ccccc12 |
| InChI | InChI=1S/C22H30ClN3O2/c1-15-17-9-5-6-10-18(17)25-19(20(15)23)14-26-11-7-8-16(13-26)12-24-21(27)28-22(2,3)4/h5-6,9-10,16H,7-8,11-14H2,1-4H3,(H,24,27) |
| InChIKey | WPQAMCUXNRQWLP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |