C17H19ClN2O2 — CID 124694319
(3S)-1-[(3-chloro-4-methylquinolin-2-yl)methyl]piperidine-3-carboxylic acid (PubChem CID 124694319) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is (3S)-1-[(3-chloro-4-methylquinolin-2-yl)methyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[(3-chloro-4-methylquinolin-2-yl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 124694319 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (3S)-1-[(3-chloro-4-methylquinolin-2-yl)methyl]piperidine-3-carboxylic acid |
| SMILES | Cc1c(Cl)c(CN2CCC[C@H](C(=O)O)C2)nc2ccccc12 |
| InChI | InChI=1S/C17H19ClN2O2/c1-11-13-6-2-3-7-14(13)19-15(16(11)18)10-20-8-4-5-12(9-20)17(21)22/h2-3,6-7,12H,4-5,8-10H2,1H3,(H,21,22)/t12-/m0/s1 |
| InChIKey | ZMBAZUPQCYANKR-LBPRGKRZSA-N |
| XLogP | 3.49 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |