C24H25N3O3 — CID 8545211
methyl 2-[[(3S)-3-carbamoylpiperidin-1-yl]methyl]-4-phenylquinoline-3-carboxylate (PubChem CID 8545211) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is methyl 2-[[(3S)-3-carbamoylpiperidin-1-yl]methyl]-4-phenylquinoline-3-carboxylate.
| Compound Name | methyl 2-[[(3S)-3-carbamoylpiperidin-1-yl]methyl]-4-phenylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 8545211 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | methyl 2-[[(3S)-3-carbamoylpiperidin-1-yl]methyl]-4-phenylquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(CN2CCC[C@H](C(N)=O)C2)nc2ccccc2c1-c1ccccc1 |
| InChI | InChI=1S/C24H25N3O3/c1-30-24(29)22-20(15-27-13-7-10-17(14-27)23(25)28)26-19-12-6-5-11-18(19)21(22)16-8-3-2-4-9-16/h2-6,8-9,11-12,17H,7,10,13-15H2,1H3,(H2,25,28)/t17-/m0/s1 |
| InChIKey | XAMYKAHSQFAOEF-KRWDZBQOSA-N |
| XLogP | 3.39 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |