About methyl 2-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-4-methylquinoline-3-carboxylate
methyl 2-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-4-methylquinoline-3-carboxylate (PubChem CID 8540042) has the molecular formula C20H26N2O2
and a molecular weight of 326.44 g/mol. Its IUPAC name is methyl 2-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-4-methylquinoline-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-4-methylquinoline-3-carboxylate |
| PubChem CID | 8540042 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | methyl 2-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-4-methylquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(CN2C[C@H](C)C[C@@H](C)C2)nc2ccccc2c1C |
| InChI | InChI=1S/C20H26N2O2/c1-13-9-14(2)11-22(10-13)12-18-19(20(23)24-4)15(3)16-7-5-6-8-17(16)21-18/h5-8,13-14H,9-12H2,1-4H3/t13-,14-/m1/s1 |
| InChIKey | AREZTGSFUVYRCA-ZIAGYGMSSA-N |
| XLogP | 3.81 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-4-methylquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-4-methylquinoline-3-carboxylate?
The IUPAC name of methyl 2-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-4-methylquinoline-3-carboxylate (CID 8540042) is methyl 2-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-4-methylquinoline-3-carboxylate.
What is the SMILES notation for methyl 2-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-4-methylquinoline-3-carboxylate?
The canonical SMILES for methyl 2-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-4-methylquinoline-3-carboxylate is COC(=O)c1c(CN2C[C@H](C)C[C@@H](C)C2)nc2ccccc2c1C.
What is the InChIKey of methyl 2-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-4-methylquinoline-3-carboxylate?
The InChIKey is AREZTGSFUVYRCA-ZIAGYGMSSA-N. The full InChI is InChI=1S/C20H26N2O2/c1-13-9-14(2)11-22(10-13)12-18-19(20(23)24-4)15(3)16-7-5-6-8-17(16)21-18/h5-8,13-14H,9-12H2,1-4H3/t13-,14-/m1/s1.
What are the key properties of methyl 2-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-4-methylquinoline-3-carboxylate?
methyl 2-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-4-methylquinoline-3-carboxylate has a molecular weight of 326.44 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-4-methylquinoline-3-carboxylate is sourced from PubChem (CID 8540042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).