C20H26N2O2 — CID 8679831
methyl 2-(azocan-1-ylmethyl)-4-methylquinoline-3-carboxylate (PubChem CID 8679831) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is methyl 2-(azocan-1-ylmethyl)-4-methylquinoline-3-carboxylate.
| Compound Name | methyl 2-(azocan-1-ylmethyl)-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 8679831 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | methyl 2-(azocan-1-ylmethyl)-4-methylquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(CN2CCCCCCC2)nc2ccccc2c1C |
| InChI | InChI=1S/C20H26N2O2/c1-15-16-10-6-7-11-17(16)21-18(19(15)20(23)24-2)14-22-12-8-4-3-5-9-13-22/h6-7,10-11H,3-5,8-9,12-14H2,1-2H3 |
| InChIKey | FKQTXHBVHUNUME-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |