C21H24N5O2+ — CID 8595371
methyl 4-methyl-2-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]quinoline-3-carboxylate (PubChem CID 8595371) has the molecular formula C21H24N5O2+ and a molecular weight of 378.46 g/mol. Its IUPAC name is methyl 4-methyl-2-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]quinoline-3-carboxylate.
| Compound Name | methyl 4-methyl-2-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 8595371 |
| Molecular Formula | C21H24N5O2+ |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | methyl 4-methyl-2-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]quinoline-3-carboxylate |
| SMILES | COC(=O)c1c(C[NH+]2CCN(c3ncccn3)CC2)nc2ccccc2c1C |
| InChI | InChI=1S/C21H23N5O2/c1-15-16-6-3-4-7-17(16)24-18(19(15)20(27)28-2)14-25-10-12-26(13-11-25)21-22-8-5-9-23-21/h3-9H,10-14H2,1-2H3/p+1 |
| InChIKey | AIURVIDCPQKTJR-UHFFFAOYSA-O |
| XLogP | 1.02 |
| TPSA | 72.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |