C18H22N3O3+ — CID 8962604
ethyl 4-methyl-2-[(3-oxopiperazin-1-ium-1-yl)methyl]quinoline-3-carboxylate (PubChem CID 8962604) has the molecular formula C18H22N3O3+ and a molecular weight of 328.39 g/mol. Its IUPAC name is ethyl 4-methyl-2-[(3-oxopiperazin-1-ium-1-yl)methyl]quinoline-3-carboxylate.
| Compound Name | ethyl 4-methyl-2-[(3-oxopiperazin-1-ium-1-yl)methyl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 8962604 |
| Molecular Formula | C18H22N3O3+ |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | ethyl 4-methyl-2-[(3-oxopiperazin-1-ium-1-yl)methyl]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(C[NH+]2CCNC(=O)C2)nc2ccccc2c1C |
| InChI | InChI=1S/C18H21N3O3/c1-3-24-18(23)17-12(2)13-6-4-5-7-14(13)20-15(17)10-21-9-8-19-16(22)11-21/h4-7H,3,8-11H2,1-2H3,(H,19,22)/p+1 |
| InChIKey | QWIKINFMFNOJEM-UHFFFAOYSA-O |
| XLogP | 0.23 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |